C22H31N5O6 — CID 26186152
3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methoxyethyl)propanamide (PubChem CID 26186152) has the molecular formula C22H31N5O6 and a molecular weight of 461.52 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 26186152 |
| Molecular Formula | C22H31N5O6 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methoxyethyl)propanamide |
| SMILES | CCCCn1c(N)c(N(CCOC)C(=O)CCN2C(=O)[C@H]3CC=CC[C@H]3C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H31N5O6/c1-3-4-10-26-18(23)17(19(29)24-22(26)32)25(12-13-33-2)16(28)9-11-27-20(30)14-7-5-6-8-15(14)21(27)31/h5-6,14-15H,3-4,7-13,23H2,1-2H3,(H,24,29,32)/t14-,15+ |
| InChIKey | GXPOVUBLONULQQ-GASCZTMLSA-N |
| XLogP | 0.24 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|