C20H27N5O5 — CID 26196408
3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-methylpropanamide (PubChem CID 26196408) has the molecular formula C20H27N5O5 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-methylpropanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 26196408 |
| Molecular Formula | C20H27N5O5 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-methylpropanamide |
| SMILES | CCCCn1c(N)c(N(C)C(=O)CCN2C(=O)[C@H]3CC=CC[C@H]3C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H27N5O5/c1-3-4-10-24-16(21)15(17(27)22-20(24)30)23(2)14(26)9-11-25-18(28)12-7-5-6-8-13(12)19(25)29/h5-6,12-13H,3-4,7-11,21H2,1-2H3,(H,22,27,30)/t12-,13+ |
| InChIKey | UDAZWHBLRQCQMH-BETUJISGSA-N |
| XLogP | 0.22 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|