C21H29N5O5 — CID 55623438
N-[4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-methylamino]-4-oxobutyl]-4-methoxybenzamide (PubChem CID 55623438) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-methylamino]-4-oxobutyl]-4-methoxybenzamide.
| Compound Name | N-[4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-methylamino]-4-oxobutyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55623438 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-methylamino]-4-oxobutyl]-4-methoxybenzamide |
| SMILES | CCCCn1c(N)c(N(C)C(=O)CCCNC(=O)c2ccc(OC)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H29N5O5/c1-4-5-13-26-18(22)17(20(29)24-21(26)30)25(2)16(27)7-6-12-23-19(28)14-8-10-15(31-3)11-9-14/h8-11H,4-7,12-13,22H2,1-3H3,(H,23,28)(H,24,29,30) |
| InChIKey | OWKQACDKVXDTOT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|