C24H29N5O5 — CID 39768831
N-[4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-(furan-2-ylmethyl)amino]-4-oxobutyl]benzamide (PubChem CID 39768831) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-(furan-2-ylmethyl)amino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-(furan-2-ylmethyl)amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 39768831 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[4-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-(furan-2-ylmethyl)amino]-4-oxobutyl]benzamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccco2)C(=O)CCCNC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H29N5O5/c1-2-3-14-28-21(25)20(23(32)27-24(28)33)29(16-18-11-8-15-34-18)19(30)12-7-13-26-22(31)17-9-5-4-6-10-17/h4-6,8-11,15H,2-3,7,12-14,16,25H2,1H3,(H,26,31)(H,27,32,33) |
| InChIKey | AVSSSEHIIMBINY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 143.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|