C23H28N4O4S — CID 26195819
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(furan-2-ylmethyl)-4-phenylsulfanylbutanamide (PubChem CID 26195819) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(furan-2-ylmethyl)-4-phenylsulfanylbutanamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(furan-2-ylmethyl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 26195819 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(furan-2-ylmethyl)-4-phenylsulfanylbutanamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccco2)C(=O)CCCSc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H28N4O4S/c1-2-3-13-26-21(24)20(22(29)25-23(26)30)27(16-17-9-7-14-31-17)19(28)12-8-15-32-18-10-5-4-6-11-18/h4-7,9-11,14H,2-3,8,12-13,15-16,24H2,1H3,(H,25,29,30) |
| InChIKey | PHZPIWZCRKDJHR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|