C25H29N5O5 — CID 55427218
N-[4-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-4-oxobutyl]-2-ethoxybenzamide (PubChem CID 55427218) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is N-[4-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-4-oxobutyl]-2-ethoxybenzamide.
| Compound Name | N-[4-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-4-oxobutyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 55427218 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-[4-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-methylamino]-4-oxobutyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)N(C)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H29N5O5/c1-3-35-19-13-8-7-12-18(19)23(32)27-15-9-14-20(31)29(2)21-22(26)30(25(34)28-24(21)33)16-17-10-5-4-6-11-17/h4-8,10-13H,3,9,14-16,26H2,1-2H3,(H,27,32)(H,28,33,34) |
| InChIKey | NRGREPGDRODDNW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|