C22H28N2O3 — CID 55919133
2-ethoxy-N-[4-oxo-4-(N,3,5-trimethylanilino)butyl]benzamide (PubChem CID 55919133) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-ethoxy-N-[4-oxo-4-(N,3,5-trimethylanilino)butyl]benzamide.
| Compound Name | 2-ethoxy-N-[4-oxo-4-(N,3,5-trimethylanilino)butyl]benzamide |
|---|---|
| PubChem CID | 55919133 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-ethoxy-N-[4-oxo-4-(N,3,5-trimethylanilino)butyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)N(C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-5-27-20-10-7-6-9-19(20)22(26)23-12-8-11-21(25)24(4)18-14-16(2)13-17(3)15-18/h6-7,9-10,13-15H,5,8,11-12H2,1-4H3,(H,23,26) |
| InChIKey | ZLNPVVPZNBWPGU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|