C20H25N3O5 — CID 9084951
N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]-2-ethoxybenzamide (PubChem CID 9084951) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]-2-ethoxybenzamide.
| Compound Name | N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 9084951 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)NNC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C20H25N3O5/c1-4-27-17-9-6-5-8-15(17)19(25)21-11-7-10-18(24)22-23-20(26)16-12-13(2)28-14(16)3/h5-6,8-9,12H,4,7,10-11H2,1-3H3,(H,21,25)(H,22,24)(H,23,26) |
| InChIKey | PQDNQGQEAGCFMU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|