C18H20ClN3O4 — CID 26820776
4-chloro-N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]benzamide (PubChem CID 26820776) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is 4-chloro-N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 26820776 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 4-chloro-N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]benzamide |
| SMILES | Cc1cc(C(=O)NNC(=O)CCCNC(=O)c2ccc(Cl)cc2)c(C)o1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-11-10-15(12(2)26-11)18(25)22-21-16(23)4-3-9-20-17(24)13-5-7-14(19)8-6-13/h5-8,10H,3-4,9H2,1-2H3,(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | WIRUKVYJFCFDAF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|