C14H13BrN2O3 — CID 2715709
N'-(4-bromobenzoyl)-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 2715709) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is N'-(4-bromobenzoyl)-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(4-bromobenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 2715709 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N'-(4-bromobenzoyl)-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(Br)cc2)c(C)o1 |
| InChI | InChI=1S/C14H13BrN2O3/c1-8-7-12(9(2)20-8)14(19)17-16-13(18)10-3-5-11(15)6-4-10/h3-7H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | VUNWJXFEXKJEOA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|