C15H16N2O3 — CID 7808967
2,5-dimethyl-N'-(2-methylbenzoyl)furan-3-carbohydrazide (PubChem CID 7808967) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2,5-dimethyl-N'-(2-methylbenzoyl)furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-(2-methylbenzoyl)furan-3-carbohydrazide |
|---|---|
| PubChem CID | 7808967 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2,5-dimethyl-N'-(2-methylbenzoyl)furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccccc2C)c(C)o1 |
| InChI | InChI=1S/C15H16N2O3/c1-9-6-4-5-7-12(9)14(18)16-17-15(19)13-8-10(2)20-11(13)3/h4-8H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | FZPMIIADMKAGMD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|