C24H22N4O3 — CID 26247359
N'-(2,5-dimethylfuran-3-carbonyl)-3-(2-methylphenyl)-1-phenylpyrazole-4-carbohydrazide (PubChem CID 26247359) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-3-(2-methylphenyl)-1-phenylpyrazole-4-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-3-(2-methylphenyl)-1-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 26247359 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-3-(2-methylphenyl)-1-phenylpyrazole-4-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2C)c(C)o1 |
| InChI | InChI=1S/C24H22N4O3/c1-15-9-7-8-12-19(15)22-21(14-28(27-22)18-10-5-4-6-11-18)24(30)26-25-23(29)20-13-16(2)31-17(20)3/h4-14H,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | XLIXZEKCGZPWGY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|