C24H22N4O — CID 78774712
3-(2,4-dimethylphenyl)-N',1-diphenylpyrazole-4-carbohydrazide (PubChem CID 78774712) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N',1-diphenylpyrazole-4-carbohydrazide.
| Compound Name | 3-(2,4-dimethylphenyl)-N',1-diphenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 78774712 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N',1-diphenylpyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NNc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H22N4O/c1-17-13-14-21(18(2)15-17)23-22(16-28(27-23)20-11-7-4-8-12-20)24(29)26-25-19-9-5-3-6-10-19/h3-16,25H,1-2H3,(H,26,29) |
| InChIKey | GHVSJUXHUQDJAV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|