C23H20N4O3 — CID 9366857
3-(2,4-dimethylphenyl)-N'-(furan-2-carbonyl)-1-phenylpyrazole-4-carbohydrazide (PubChem CID 9366857) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N'-(furan-2-carbonyl)-1-phenylpyrazole-4-carbohydrazide.
| Compound Name | 3-(2,4-dimethylphenyl)-N'-(furan-2-carbonyl)-1-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9366857 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N'-(furan-2-carbonyl)-1-phenylpyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NNC(=O)c2ccco2)c(C)c1 |
| InChI | InChI=1S/C23H20N4O3/c1-15-10-11-18(16(2)13-15)21-19(14-27(26-21)17-7-4-3-5-8-17)22(28)24-25-23(29)20-9-6-12-30-20/h3-14H,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | XHSKVOSLOOBLIW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|