C28H24N4O2 — CID 55950805
3-(2,4-dimethylphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 55950805) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(2,4-dimethylphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55950805 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)c2cn(-c3ccccc3)nc2-c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C28H24N4O2/c1-4-21-9-8-10-22(16-21)30-26(33)17-29-28(34)25-18-32(23-11-6-5-7-12-23)31-27(25)24-14-13-19(2)15-20(24)3/h1,5-16,18H,17H2,2-3H3,(H,29,34)(H,30,33) |
| InChIKey | NMLUMWMBBVPOQP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|