C26H24N6O3 — CID 38746104
1-[2-[2-(1,3-diphenylpyrazole-4-carbonyl)hydrazinyl]-2-oxoethyl]-3-(3-methylphenyl)urea (PubChem CID 38746104) has the molecular formula C26H24N6O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 1-[2-[2-(1,3-diphenylpyrazole-4-carbonyl)hydrazinyl]-2-oxoethyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[2-[2-(1,3-diphenylpyrazole-4-carbonyl)hydrazinyl]-2-oxoethyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 38746104 |
| Molecular Formula | C26H24N6O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 1-[2-[2-(1,3-diphenylpyrazole-4-carbonyl)hydrazinyl]-2-oxoethyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NCC(=O)NNC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N6O3/c1-18-9-8-12-20(15-18)28-26(35)27-16-23(33)29-30-25(34)22-17-32(21-13-6-3-7-14-21)31-24(22)19-10-4-2-5-11-19/h2-15,17H,16H2,1H3,(H,29,33)(H,30,34)(H2,27,28,35) |
| InChIKey | HLZPMNGBZFFTDW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|