C27H24N4O4 — CID 55962642
methyl 2-[[3-[[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]amino]benzoyl]amino]acetate (PubChem CID 55962642) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is methyl 2-[[3-[[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55962642 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | methyl 2-[[3-[[1-(4-methylphenyl)-3-phenylpyrazole-4-carbonyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cccc(NC(=O)c2cn(-c3ccc(C)cc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C27H24N4O4/c1-18-11-13-22(14-12-18)31-17-23(25(30-31)19-7-4-3-5-8-19)27(34)29-21-10-6-9-20(15-21)26(33)28-16-24(32)35-2/h3-15,17H,16H2,1-2H3,(H,28,33)(H,29,34) |
| InChIKey | KNOYECSDKJWWSC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |