C25H22N4O2 — CID 31858323
N-[4-(2-amino-2-oxoethyl)phenyl]-1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide (PubChem CID 31858323) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31858323 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)Nc3ccc(CC(N)=O)cc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H22N4O2/c1-17-7-13-21(14-8-17)29-16-22(24(28-29)19-5-3-2-4-6-19)25(31)27-20-11-9-18(10-12-20)15-23(26)30/h2-14,16H,15H2,1H3,(H2,26,30)(H,27,31) |
| InChIKey | BWRBPKAIWZWGPY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |