C20H21N3O3 — CID 175080965
1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide;propanoic acid (PubChem CID 175080965) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide;propanoic acid.
| Compound Name | 1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide;propanoic acid |
|---|---|
| PubChem CID | 175080965 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide;propanoic acid |
| SMILES | CCC(=O)O.Cc1ccc(-n2cc(C(N)=O)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H15N3O.C3H6O2/c1-12-7-9-14(10-8-12)20-11-15(17(18)21)16(19-20)13-5-3-2-4-6-13;1-2-3(4)5/h2-11H,1H3,(H2,18,21);2H2,1H3,(H,4,5) |
| InChIKey | ZTVVNDOMVRLVKY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |