C25H21N3O3 — CID 1355724
ethyl 4-[(1,3-diphenylpyrazole-4-carbonyl)amino]benzoate (PubChem CID 1355724) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is ethyl 4-[(1,3-diphenylpyrazole-4-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(1,3-diphenylpyrazole-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 1355724 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | ethyl 4-[(1,3-diphenylpyrazole-4-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O3/c1-2-31-25(30)19-13-15-20(16-14-19)26-24(29)22-17-28(21-11-7-4-8-12-21)27-23(22)18-9-5-3-6-10-18/h3-17H,2H2,1H3,(H,26,29) |
| InChIKey | PSRIIEFYPRFVAL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |