C38H34N4O6 — CID 44614839
ethyl 4-[[2-[(4-ethoxycarbonylphenyl)carbamoyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]amino]benzoate (PubChem CID 44614839) has the molecular formula C38H34N4O6 and a molecular weight of 642.71 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-ethoxycarbonylphenyl)carbamoyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(4-ethoxycarbonylphenyl)carbamoyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 44614839 |
| Molecular Formula | C38H34N4O6 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | ethyl 4-[[2-[(4-ethoxycarbonylphenyl)carbamoyl]-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=Cc2cn(-c3ccccc3)nc2-c2ccc(C)cc2)C(=O)Nc2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C38H34N4O6/c1-4-47-37(45)27-15-19-30(20-16-27)39-35(43)33(36(44)40-31-21-17-28(18-22-31)38(46)48-5-2)23-29-24-42(32-9-7-6-8-10-32)41-34(29)26-13-11-25(3)12-14-26/h6-24H,4-5H2,1-3H3,(H,39,43)(H,40,44) |
| InChIKey | ZINLSZGTDQCPGW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|