C40H37ClN4O7 — CID 4700511
ethyl 4-[[3-[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-[(4-ethoxycarbonylphenyl)carbamoyl]prop-2-enoyl]amino]benzoate (PubChem CID 4700511) has the molecular formula C40H37ClN4O7 and a molecular weight of 721.21 g/mol. Its IUPAC name is ethyl 4-[[3-[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-[(4-ethoxycarbonylphenyl)carbamoyl]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-[(4-ethoxycarbonylphenyl)carbamoyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 4700511 |
| Molecular Formula | C40H37ClN4O7 |
| Molecular Weight | 721.21 g/mol |
| Exact Mass | 720.24 |
| IUPAC Name | ethyl 4-[[3-[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-[(4-ethoxycarbonylphenyl)carbamoyl]prop-2-enoyl]amino]benzoate |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2C=C(C(=O)Nc2ccc(C(=O)OCC)cc2)C(=O)Nc2ccc(C(=O)OCC)cc2)cc1Cl |
| InChI | InChI=1S/C40H37ClN4O7/c1-4-22-52-35-21-16-28(24-34(35)41)36-29(25-45(44-36)32-10-8-7-9-11-32)23-33(37(46)42-30-17-12-26(13-18-30)39(48)50-5-2)38(47)43-31-19-14-27(15-20-31)40(49)51-6-3/h7-21,23-25H,4-6,22H2,1-3H3,(H,42,46)(H,43,47) |
| InChIKey | KTUNEYKGOKGITA-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.21 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|