C36H31ClN4O2S — CID 18806428
(4Z)-4-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one (PubChem CID 18806428) has the molecular formula C36H31ClN4O2S and a molecular weight of 619.19 g/mol. Its IUPAC name is (4Z)-4-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 18806428 |
| Molecular Formula | C36H31ClN4O2S |
| Molecular Weight | 619.19 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | (4Z)-4-[[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\C(=O)N(c3ccccc3)N=C2CSc2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C36H31ClN4O2S/c1-3-20-43-34-19-16-26(22-32(34)37)35-27(23-40(39-35)28-10-6-4-7-11-28)21-31-33(24-44-30-17-14-25(2)15-18-30)38-41(36(31)42)29-12-8-5-9-13-29/h4-19,21-23H,3,20,24H2,1-2H3/b31-21- |
| InChIKey | GIRGKIOZDANPAJ-YQYKVWLJSA-N |
| XLogP | 8.87 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.19 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|