C37H34N4OS2 — CID 6192235
(4Z)-4-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one (PubChem CID 6192235) has the molecular formula C37H34N4OS2 and a molecular weight of 614.84 g/mol. Its IUPAC name is (4Z)-4-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 6192235 |
| Molecular Formula | C37H34N4OS2 |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | (4Z)-4-[[3-(4-butylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
| SMILES | CCCCSc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\C(=O)N(c3ccccc3)N=C2CSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H34N4OS2/c1-3-4-23-43-32-21-17-28(18-22-32)36-29(25-40(39-36)30-11-7-5-8-12-30)24-34-35(26-44-33-19-15-27(2)16-20-33)38-41(37(34)42)31-13-9-6-10-14-31/h5-22,24-25H,3-4,23,26H2,1-2H3/b34-24- |
| InChIKey | WOGCMLOTXNNQRD-BCJTWVECSA-N |
| XLogP | 9.32 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|