C36H28N4O3S — CID 4864397
4-[[3-(7-methoxy-1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one (PubChem CID 4864397) has the molecular formula C36H28N4O3S and a molecular weight of 596.71 g/mol. Its IUPAC name is 4-[[3-(7-methoxy-1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-(7-methoxy-1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4864397 |
| Molecular Formula | C36H28N4O3S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 4-[[3-(7-methoxy-1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
| SMILES | COc1cccc2cc(-c3nn(-c4ccccc4)cc3C=C3C(=O)N(c4ccccc4)N=C3CSc3ccc(C)cc3)oc12 |
| InChI | InChI=1S/C36H28N4O3S/c1-24-16-18-29(19-17-24)44-23-31-30(36(41)40(37-31)28-13-7-4-8-14-28)20-26-22-39(27-11-5-3-6-12-27)38-34(26)33-21-25-10-9-15-32(42-2)35(25)43-33/h3-22H,23H2,1-2H3 |
| InChIKey | SKSLHUGRXZPGHY-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 72.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|