C32H27N3O5S2 — CID 6221246
(5Z)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-(7-methoxy-1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6221246) has the molecular formula C32H27N3O5S2 and a molecular weight of 597.72 g/mol. Its IUPAC name is (5Z)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-(7-methoxy-1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-(7-methoxy-1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6221246 |
| Molecular Formula | C32H27N3O5S2 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | (5Z)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-(7-methoxy-1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CCN2C(=O)/C(=C/c3cn(-c4ccccc4)nc3-c3cc4cccc(OC)c4o3)SC2=S)cc1OC |
| InChI | InChI=1S/C32H27N3O5S2/c1-37-24-13-12-20(16-26(24)39-3)14-15-34-31(36)28(42-32(34)41)18-22-19-35(23-9-5-4-6-10-23)33-29(22)27-17-21-8-7-11-25(38-2)30(21)40-27/h4-13,16-19H,14-15H2,1-3H3/b28-18- |
| InChIKey | SZYWPVKZXKLTFI-VEILYXNESA-N |
| XLogP | 6.76 |
| TPSA | 78.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|