C31H29N3O4S2 — CID 5130382
3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-(4-methoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5130382) has the molecular formula C31H29N3O4S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-(4-methoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-(4-methoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5130382 |
| Molecular Formula | C31H29N3O4S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-(4-methoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=C2SC(=S)N(CCc3ccc(OC)c(OC)c3)C2=O)cc1C |
| InChI | InChI=1S/C31H29N3O4S2/c1-20-16-22(11-13-25(20)36-2)29-23(19-34(32-29)24-8-6-5-7-9-24)18-28-30(35)33(31(39)40-28)15-14-21-10-12-26(37-3)27(17-21)38-4/h5-13,16-19H,14-15H2,1-4H3 |
| InChIKey | GSCLDFIRJQYUID-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|