C36H30FN3O4S2 — CID 4700081
3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4700081) has the molecular formula C36H30FN3O4S2 and a molecular weight of 651.79 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4700081 |
| Molecular Formula | C36H30FN3O4S2 |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CCN2C(=O)C(=Cc3cn(-c4ccccc4)nc3-c3cccc(OCc4ccccc4F)c3)SC2=S)cc1OC |
| InChI | InChI=1S/C36H30FN3O4S2/c1-42-31-16-15-24(19-32(31)43-2)17-18-39-35(41)33(46-36(39)45)21-27-22-40(28-11-4-3-5-12-28)38-34(27)25-10-8-13-29(20-25)44-23-26-9-6-7-14-30(26)37/h3-16,19-22H,17-18,23H2,1-2H3 |
| InChIKey | ZHMGRBBGLGMVAN-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|