C37H33ClN4O2S — CID 18806448
(4Z)-4-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one (PubChem CID 18806448) has the molecular formula C37H33ClN4O2S and a molecular weight of 633.22 g/mol. Its IUPAC name is (4Z)-4-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 18806448 |
| Molecular Formula | C37H33ClN4O2S |
| Molecular Weight | 633.22 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | (4Z)-4-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-5-[(4-methylphenyl)sulfanylmethyl]-2-phenylpyrazol-3-one |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\C(=O)N(c3ccccc3)N=C2CSc2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C37H33ClN4O2S/c1-3-4-21-44-35-20-17-27(23-33(35)38)36-28(24-41(40-36)29-11-7-5-8-12-29)22-32-34(25-45-31-18-15-26(2)16-19-31)39-42(37(32)43)30-13-9-6-10-14-30/h5-20,22-24H,3-4,21,25H2,1-2H3/b32-22- |
| InChIKey | SNLPDLFDFHHLHG-JDCMOKTRSA-N |
| XLogP | 9.26 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.22 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|