C31H31ClN4O3 — CID 19109860
(5E)-5-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-butyl-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19109860) has the molecular formula C31H31ClN4O3 and a molecular weight of 543.07 g/mol. Its IUPAC name is (5E)-5-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-butyl-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-butyl-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19109860 |
| Molecular Formula | C31H31ClN4O3 |
| Molecular Weight | 543.07 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | (5E)-5-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-butyl-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCCC)C(=O)C(C#N)=C2C)cc1Cl |
| InChI | InChI=1S/C31H31ClN4O3/c1-4-6-15-35-30(37)25(21(3)26(19-33)31(35)38)17-23-20-36(24-11-9-8-10-12-24)34-29(23)22-13-14-28(27(32)18-22)39-16-7-5-2/h8-14,17-18,20H,4-7,15-16H2,1-3H3/b25-17+ |
| InChIKey | TYUBLCGXPABMHY-KOEQRZSOSA-N |
| XLogP | 6.76 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.07 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|