C36H33ClN4O4 — CID 19113047
(5E)-5-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19113047) has the molecular formula C36H33ClN4O4 and a molecular weight of 621.14 g/mol. Its IUPAC name is (5E)-5-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19113047 |
| Molecular Formula | C36H33ClN4O4 |
| Molecular Weight | 621.14 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | (5E)-5-[[3-(4-butoxy-3-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCc3ccc(OC)cc3)C(=O)C(C#N)=C2C)cc1Cl |
| InChI | InChI=1S/C36H33ClN4O4/c1-4-5-19-45-33-16-13-26(21-32(33)37)34-27(23-41(39-34)28-9-7-6-8-10-28)20-30-24(2)31(22-38)36(43)40(35(30)42)18-17-25-11-14-29(44-3)15-12-25/h6-16,20-21,23H,4-5,17-19H2,1-3H3/b30-20+ |
| InChIKey | JMWMMVWNULEWAW-TWKHWXDSSA-N |
| XLogP | 7.22 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.14 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|