C35H32N4O4 — CID 19112872
(5E)-1-[(4-methoxyphenyl)methyl]-4-methyl-5-[[3-(3-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112872) has the molecular formula C35H32N4O4 and a molecular weight of 572.67 g/mol. Its IUPAC name is (5E)-1-[(4-methoxyphenyl)methyl]-4-methyl-5-[[3-(3-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-[(4-methoxyphenyl)methyl]-4-methyl-5-[[3-(3-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112872 |
| Molecular Formula | C35H32N4O4 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | (5E)-1-[(4-methoxyphenyl)methyl]-4-methyl-5-[[3-(3-methyl-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(Cc3ccc(OC)cc3)C(=O)C(C#N)=C2C)cc1C |
| InChI | InChI=1S/C35H32N4O4/c1-5-17-43-32-16-13-26(18-23(32)2)33-27(22-39(37-33)28-9-7-6-8-10-28)19-30-24(3)31(20-36)35(41)38(34(30)40)21-25-11-14-29(42-4)15-12-25/h6-16,18-19,22H,5,17,21H2,1-4H3/b30-19+ |
| InChIKey | VZHFXMBVROVWKN-NDZAJKAJSA-N |
| XLogP | 6.44 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|