C36H34N4O4 — CID 19112886
(5E)-5-[[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112886) has the molecular formula C36H34N4O4 and a molecular weight of 586.69 g/mol. Its IUPAC name is (5E)-5-[[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112886 |
| Molecular Formula | C36H34N4O4 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | (5E)-5-[[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(Cc3ccc(OC)cc3)C(=O)C(C#N)=C2C)c(C)c1 |
| InChI | InChI=1S/C36H34N4O4/c1-5-6-18-44-30-16-17-31(24(2)19-30)34-27(23-40(38-34)28-10-8-7-9-11-28)20-32-25(3)33(21-37)36(42)39(35(32)41)22-26-12-14-29(43-4)15-13-26/h7-17,19-20,23H,5-6,18,22H2,1-4H3/b32-20+ |
| InChIKey | HZTJIFGGOPNTLC-UZWMFBFFSA-N |
| XLogP | 6.83 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|