C31H23N5O5 — CID 19112864
(5E)-1-[(4-methoxyphenyl)methyl]-4-methyl-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112864) has the molecular formula C31H23N5O5 and a molecular weight of 545.56 g/mol. Its IUPAC name is (5E)-1-[(4-methoxyphenyl)methyl]-4-methyl-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-[(4-methoxyphenyl)methyl]-4-methyl-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112864 |
| Molecular Formula | C31H23N5O5 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | (5E)-1-[(4-methoxyphenyl)methyl]-4-methyl-5-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(CN2C(=O)C(C#N)=C(C)/C(=C\c3cn(-c4ccccc4)nc3-c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C31H23N5O5/c1-20-27(30(37)34(31(38)28(20)17-32)18-21-8-14-26(41-2)15-9-21)16-23-19-35(24-6-4-3-5-7-24)33-29(23)22-10-12-25(13-11-22)36(39)40/h3-16,19H,18H2,1-2H3/b27-16+ |
| InChIKey | YSLRGZUWJKQVMH-JVWAILMASA-N |
| XLogP | 5.25 |
| TPSA | 131.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|