C33H28N4O5 — CID 19112852
(5E)-5-[[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112852) has the molecular formula C33H28N4O5 and a molecular weight of 560.61 g/mol. Its IUPAC name is (5E)-5-[[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112852 |
| Molecular Formula | C33H28N4O5 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | (5E)-5-[[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1-[(4-methoxyphenyl)methyl]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(CN2C(=O)C(C#N)=C(C)/C(=C\c3cn(-c4ccccc4)nc3-c3ccc(OC)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C33H28N4O5/c1-21-27(32(38)36(33(39)28(21)18-34)19-22-10-13-26(40-2)14-11-22)16-24-20-37(25-8-6-5-7-9-25)35-31(24)23-12-15-29(41-3)30(17-23)42-4/h5-17,20H,19H2,1-4H3/b27-16+ |
| InChIKey | MXGHGXVQXUGQEO-JVWAILMASA-N |
| XLogP | 5.36 |
| TPSA | 106.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|