C34H30N4O4 — CID 19112443
(5E)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-methyl-5-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19112443) has the molecular formula C34H30N4O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is (5E)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-methyl-5-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-methyl-5-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112443 |
| Molecular Formula | C34H30N4O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (5E)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-methyl-5-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(CCN2C(=O)C(C#N)=C(C)/C(=C\c3cn(-c4ccccc4)nc3-c3ccc(C)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C34H30N4O4/c1-22-10-13-25(14-11-22)32-26(21-38(36-32)27-8-6-5-7-9-27)19-28-23(2)29(20-35)34(40)37(33(28)39)17-16-24-12-15-30(41-3)31(18-24)42-4/h5-15,18-19,21H,16-17H2,1-4H3/b28-19+ |
| InChIKey | KBRWRPQLVOEEBD-TURZUDJPSA-N |
| XLogP | 5.70 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|