C38H30N4O3 — CID 19112622
(5E)-4-methyl-1-[(4-methylphenyl)methyl]-2,6-dioxo-5-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile (PubChem CID 19112622) has the molecular formula C38H30N4O3 and a molecular weight of 590.68 g/mol. Its IUPAC name is (5E)-4-methyl-1-[(4-methylphenyl)methyl]-2,6-dioxo-5-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-1-[(4-methylphenyl)methyl]-2,6-dioxo-5-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19112622 |
| Molecular Formula | C38H30N4O3 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | (5E)-4-methyl-1-[(4-methylphenyl)methyl]-2,6-dioxo-5-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2ccc(C)cc2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H30N4O3/c1-26-13-15-28(16-14-26)23-41-37(43)34(27(2)35(22-39)38(41)44)21-31-24-42(32-11-7-4-8-12-32)40-36(31)30-17-19-33(20-18-30)45-25-29-9-5-3-6-10-29/h3-21,24H,23,25H2,1-2H3/b34-21+ |
| InChIKey | GHXANKGZYLFBQX-KEIPNQJHSA-N |
| XLogP | 7.22 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|