C34H31N5O3 — CID 19111366
(5E)-4-methyl-5-[[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile (PubChem CID 19111366) has the molecular formula C34H31N5O3 and a molecular weight of 557.65 g/mol. Its IUPAC name is (5E)-4-methyl-5-[[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-5-[[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111366 |
| Molecular Formula | C34H31N5O3 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (5E)-4-methyl-5-[[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(Cc2cccnc2)C(=O)/C1=C/c1cn(-c2ccccc2)nc1-c1ccc(OCCC(C)C)cc1 |
| InChI | InChI=1S/C34H31N5O3/c1-23(2)15-17-42-29-13-11-26(12-14-29)32-27(22-39(37-32)28-9-5-4-6-10-28)18-30-24(3)31(19-35)34(41)38(33(30)40)21-25-8-7-16-36-20-25/h4-14,16,18,20,22-23H,15,17,21H2,1-3H3/b30-18+ |
| InChIKey | SXNSINDFYWDZJW-UXHLAJHPSA-N |
| XLogP | 6.15 |
| TPSA | 101.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|