C31H32N4O4 — CID 19111102
(5E)-1-(3-ethoxypropyl)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile (PubChem CID 19111102) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is (5E)-1-(3-ethoxypropyl)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile.
| Compound Name | (5E)-1-(3-ethoxypropyl)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111102 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | (5E)-1-(3-ethoxypropyl)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]pyridine-3-carbonitrile |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCCOCC)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C31H32N4O4/c1-4-17-39-26-14-12-23(13-15-26)29-24(21-35(33-29)25-10-7-6-8-11-25)19-27-22(3)28(20-32)31(37)34(30(27)36)16-9-18-38-5-2/h6-8,10-15,19,21H,4-5,9,16-18H2,1-3H3/b27-19+ |
| InChIKey | LFBSPNHTQJEKMM-ZXVVBBHZSA-N |
| XLogP | 5.35 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|