C32H32N4O4 — CID 19111254
(5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile (PubChem CID 19111254) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111254 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-prop-2-enoxyphenyl)pyrazol-4-yl]methylidene]-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile |
| SMILES | C=CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCCOC(C)C)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C32H32N4O4/c1-5-17-40-27-14-12-24(13-15-27)30-25(21-36(34-30)26-10-7-6-8-11-26)19-28-23(4)29(20-33)32(38)35(31(28)37)16-9-18-39-22(2)3/h5-8,10-15,19,21-22H,1,9,16-18H2,2-4H3/b28-19+ |
| InChIKey | IPPSJZINPKUMOF-TURZUDJPSA-N |
| XLogP | 5.51 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|