C29H27N5O5 — CID 19111272
(5E)-4-methyl-5-[[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile (PubChem CID 19111272) has the molecular formula C29H27N5O5 and a molecular weight of 525.57 g/mol. Its IUPAC name is (5E)-4-methyl-5-[[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-5-[[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111272 |
| Molecular Formula | C29H27N5O5 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | (5E)-4-methyl-5-[[1-(4-nitrophenyl)-3-phenylpyrazol-4-yl]methylidene]-2,6-dioxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CCCOC(C)C)C(=O)/C1=C/c1cn(-c2ccc([N+](=O)[O-])cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H27N5O5/c1-19(2)39-15-7-14-32-28(35)25(20(3)26(17-30)29(32)36)16-22-18-33(23-10-12-24(13-11-23)34(37)38)31-27(22)21-8-5-4-6-9-21/h4-6,8-13,16,18-19H,7,14-15H2,1-3H3/b25-16+ |
| InChIKey | RKTDAIWOVZUINN-PCLIKHOPSA-N |
| XLogP | 4.85 |
| TPSA | 131.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|