C29H27N5O4 — CID 19110102
(5E)-1-hexyl-4-methyl-5-[[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19110102) has the molecular formula C29H27N5O4 and a molecular weight of 509.57 g/mol. Its IUPAC name is (5E)-1-hexyl-4-methyl-5-[[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-hexyl-4-methyl-5-[[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19110102 |
| Molecular Formula | C29H27N5O4 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | (5E)-1-hexyl-4-methyl-5-[[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCCCN1C(=O)C(C#N)=C(C)/C(=C\c2cn(-c3ccccc3)nc2-c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C29H27N5O4/c1-3-4-5-9-15-32-28(35)25(20(2)26(18-30)29(32)36)17-22-19-33(23-12-7-6-8-13-23)31-27(22)21-11-10-14-24(16-21)34(37)38/h6-8,10-14,16-17,19H,3-5,9,15H2,1-2H3/b25-17+ |
| InChIKey | YEBLJKLTXMBHEI-KOEQRZSOSA-N |
| XLogP | 5.62 |
| TPSA | 122.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|