C29H28N4O3 — CID 19109732
(5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]methylidene]-1-propylpyridine-3-carbonitrile (PubChem CID 19109732) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]methylidene]-1-propylpyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]methylidene]-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19109732 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | (5E)-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]methylidene]-1-propylpyridine-3-carbonitrile |
| SMILES | CCCOc1cccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCC)C(=O)C(C#N)=C2C)c1 |
| InChI | InChI=1S/C29H28N4O3/c1-4-14-32-28(34)25(20(3)26(18-30)29(32)35)17-22-19-33(23-11-7-6-8-12-23)31-27(22)21-10-9-13-24(16-21)36-15-5-2/h6-13,16-17,19H,4-5,14-15H2,1-3H3/b25-17+ |
| InChIKey | BPQAGBQRPAMCCI-KOEQRZSOSA-N |
| XLogP | 5.33 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|