C32H32N4O6 — CID 19113717
2-[2-[(5E)-3-cyano-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]-1-pyridinyl]ethoxy]ethyl acetate (PubChem CID 19113717) has the molecular formula C32H32N4O6 and a molecular weight of 568.63 g/mol. Its IUPAC name is 2-[2-[(5E)-3-cyano-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]-1-pyridinyl]ethoxy]ethyl acetate.
| Compound Name | 2-[2-[(5E)-3-cyano-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]-1-pyridinyl]ethoxy]ethyl acetate |
|---|---|
| PubChem CID | 19113717 |
| Molecular Formula | C32H32N4O6 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 2-[2-[(5E)-3-cyano-4-methyl-2,6-dioxo-5-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]-1-pyridinyl]ethoxy]ethyl acetate |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCOCCOC(C)=O)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C32H32N4O6/c1-4-15-42-27-12-10-24(11-13-27)30-25(21-36(34-30)26-8-6-5-7-9-26)19-28-22(2)29(20-33)32(39)35(31(28)38)14-16-40-17-18-41-23(3)37/h5-13,19,21H,4,14-18H2,1-3H3/b28-19+ |
| InChIKey | BSQNUTJBWZAANC-TURZUDJPSA-N |
| XLogP | 4.50 |
| TPSA | 123.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|