C31H29N5O8 — CID 19113705
2-[2-[(5E)-3-cyano-5-[[3-(4-ethoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethoxy]ethyl acetate (PubChem CID 19113705) has the molecular formula C31H29N5O8 and a molecular weight of 599.60 g/mol. Its IUPAC name is 2-[2-[(5E)-3-cyano-5-[[3-(4-ethoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethoxy]ethyl acetate.
| Compound Name | 2-[2-[(5E)-3-cyano-5-[[3-(4-ethoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethoxy]ethyl acetate |
|---|---|
| PubChem CID | 19113705 |
| Molecular Formula | C31H29N5O8 |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-[2-[(5E)-3-cyano-5-[[3-(4-ethoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethoxy]ethyl acetate |
| SMILES | CCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCOCCOC(C)=O)C(=O)C(C#N)=C2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H29N5O8/c1-4-43-28-11-10-22(17-27(28)36(40)41)29-23(19-35(33-29)24-8-6-5-7-9-24)16-25-20(2)26(18-32)31(39)34(30(25)38)12-13-42-14-15-44-21(3)37/h5-11,16-17,19H,4,12-15H2,1-3H3/b25-16+ |
| InChIKey | ZTZQHOGGYKOPMJ-PCLIKHOPSA-N |
| XLogP | 4.02 |
| TPSA | 166.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|