C29H25N5O7 — CID 19113564
3-[(5E)-3-cyano-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]propyl acetate (PubChem CID 19113564) has the molecular formula C29H25N5O7 and a molecular weight of 555.55 g/mol. Its IUPAC name is 3-[(5E)-3-cyano-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]propyl acetate.
| Compound Name | 3-[(5E)-3-cyano-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]propyl acetate |
|---|---|
| PubChem CID | 19113564 |
| Molecular Formula | C29H25N5O7 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 3-[(5E)-3-cyano-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]propyl acetate |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCCOC(C)=O)C(=O)C(C#N)=C2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H25N5O7/c1-18-23(28(36)32(29(37)24(18)16-30)12-7-13-41-19(2)35)14-21-17-33(22-8-5-4-6-9-22)31-27(21)20-10-11-26(40-3)25(15-20)34(38)39/h4-6,8-11,14-15,17H,7,12-13H2,1-3H3/b23-14+ |
| InChIKey | OAGBFGQHNKEXPV-OEAKJJBVSA-N |
| XLogP | 4.00 |
| TPSA | 157.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|