C29H27N5O6 — CID 19111080
(5E)-1-(3-ethoxypropyl)-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19111080) has the molecular formula C29H27N5O6 and a molecular weight of 541.56 g/mol. Its IUPAC name is (5E)-1-(3-ethoxypropyl)-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-(3-ethoxypropyl)-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111080 |
| Molecular Formula | C29H27N5O6 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | (5E)-1-(3-ethoxypropyl)-5-[[3-(4-methoxy-3-nitrophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCOCCCN1C(=O)C(C#N)=C(C)/C(=C\c2cn(-c3ccccc3)nc2-c2ccc(OC)c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C29H27N5O6/c1-4-40-14-8-13-32-28(35)23(19(2)24(17-30)29(32)36)15-21-18-33(22-9-6-5-7-10-22)31-27(21)20-11-12-26(39-3)25(16-20)34(37)38/h5-7,9-12,15-16,18H,4,8,13-14H2,1-3H3/b23-15+ |
| InChIKey | GZMXUESJPPJQMT-HZHRSRAPSA-N |
| XLogP | 4.47 |
| TPSA | 140.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|