C31H31N5O7S — CID 19113758
2-[2-[(5E)-3-cyano-5-[[3-[3-(dimethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethoxy]ethyl acetate (PubChem CID 19113758) has the molecular formula C31H31N5O7S and a molecular weight of 617.68 g/mol. Its IUPAC name is 2-[2-[(5E)-3-cyano-5-[[3-[3-(dimethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethoxy]ethyl acetate.
| Compound Name | 2-[2-[(5E)-3-cyano-5-[[3-[3-(dimethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethoxy]ethyl acetate |
|---|---|
| PubChem CID | 19113758 |
| Molecular Formula | C31H31N5O7S |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | 2-[2-[(5E)-3-cyano-5-[[3-[3-(dimethylsulfamoyl)phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-methyl-2,6-dioxo-1-pyridinyl]ethoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCCN1C(=O)C(C#N)=C(C)/C(=C\c2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N(C)C)c2)C1=O |
| InChI | InChI=1S/C31H31N5O7S/c1-21-27(30(38)35(31(39)28(21)19-32)13-14-42-15-16-43-22(2)37)18-24-20-36(25-10-6-5-7-11-25)33-29(24)23-9-8-12-26(17-23)44(40,41)34(3)4/h5-12,17-18,20H,13-16H2,1-4H3/b27-18+ |
| InChIKey | SHPCDFWPBQUWLC-OVVQPSECSA-N |
| XLogP | 2.96 |
| TPSA | 151.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|