C33H37N5O5S — CID 19111282
3-[4-[(E)-[5-cyano-4-methyl-2,6-dioxo-1-(3-propan-2-yloxypropyl)-3-pyridinylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 19111282) has the molecular formula C33H37N5O5S and a molecular weight of 615.76 g/mol. Its IUPAC name is 3-[4-[(E)-[5-cyano-4-methyl-2,6-dioxo-1-(3-propan-2-yloxypropyl)-3-pyridinylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[4-[(E)-[5-cyano-4-methyl-2,6-dioxo-1-(3-propan-2-yloxypropyl)-3-pyridinylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19111282 |
| Molecular Formula | C33H37N5O5S |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 3-[4-[(E)-[5-cyano-4-methyl-2,6-dioxo-1-(3-propan-2-yloxypropyl)-3-pyridinylidene]methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(CCCOC(C)C)C(=O)C(C#N)=C2C)c1 |
| InChI | InChI=1S/C33H37N5O5S/c1-6-36(7-2)44(41,42)28-16-11-13-25(19-28)31-26(22-38(35-31)27-14-9-8-10-15-27)20-29-24(5)30(21-34)33(40)37(32(29)39)17-12-18-43-23(3)4/h8-11,13-16,19-20,22-23H,6-7,12,17-18H2,1-5H3/b29-20+ |
| InChIKey | SZSAINGVSPXONN-ZTKZIYFRSA-N |
| XLogP | 4.98 |
| TPSA | 125.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|