C30H29N5O4S — CID 19112075
3-[4-[(E)-(5-cyano-4-methyl-2,6-dioxo-1-prop-2-enyl-3-pyridinylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 19112075) has the molecular formula C30H29N5O4S and a molecular weight of 555.66 g/mol. Its IUPAC name is 3-[4-[(E)-(5-cyano-4-methyl-2,6-dioxo-1-prop-2-enyl-3-pyridinylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[4-[(E)-(5-cyano-4-methyl-2,6-dioxo-1-prop-2-enyl-3-pyridinylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19112075 |
| Molecular Formula | C30H29N5O4S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 3-[4-[(E)-(5-cyano-4-methyl-2,6-dioxo-1-prop-2-enyl-3-pyridinylidene)methyl]-1-phenylpyrazol-3-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | C=CCN1C(=O)C(C#N)=C(C)/C(=C\c2cn(-c3ccccc3)nc2-c2cccc(S(=O)(=O)N(CC)CC)c2)C1=O |
| InChI | InChI=1S/C30H29N5O4S/c1-5-16-34-29(36)26(21(4)27(19-31)30(34)37)18-23-20-35(24-13-9-8-10-14-24)32-28(23)22-12-11-15-25(17-22)40(38,39)33(6-2)7-3/h5,8-15,17-18,20H,1,6-7,16H2,2-4H3/b26-18+ |
| InChIKey | VSMBPHDWACSODC-NLRVBDNBSA-N |
| XLogP | 4.35 |
| TPSA | 116.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|